C28H26ClN3O5 — CID 21077762
4-(3-chlorophenyl)-6-methyl-2-oxo-3-[3-[(4-phenoxybenzoyl)amino]propyl]-1,4-dihydropyrimidine-5-carboxylic acid (PubChem CID 21077762) has the molecular formula C28H26ClN3O5 and a molecular weight of 519.99 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-6-methyl-2-oxo-3-[3-[(4-phenoxybenzoyl)amino]propyl]-1,4-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 4-(3-chlorophenyl)-6-methyl-2-oxo-3-[3-[(4-phenoxybenzoyl)amino]propyl]-1,4-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 21077762 |
| Molecular Formula | C28H26ClN3O5 |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 4-(3-chlorophenyl)-6-methyl-2-oxo-3-[3-[(4-phenoxybenzoyl)amino]propyl]-1,4-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc(Cl)c2)N(CCCNC(=O)c2ccc(Oc3ccccc3)cc2)C(=O)N1 |
| InChI | InChI=1S/C28H26ClN3O5/c1-18-24(27(34)35)25(20-7-5-8-21(29)17-20)32(28(36)31-18)16-6-15-30-26(33)19-11-13-23(14-12-19)37-22-9-3-2-4-10-22/h2-5,7-14,17,25H,6,15-16H2,1H3,(H,30,33)(H,31,36)(H,34,35) |
| InChIKey | LPWNKRMXXHIIAK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|