C23H27N3O2 — CID 21078779
N-methyl-4-[2-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-N-pentylbenzamide (PubChem CID 21078779) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-methyl-4-[2-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-N-pentylbenzamide.
| Compound Name | N-methyl-4-[2-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 21078779 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-methyl-4-[2-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-N-pentylbenzamide |
| SMILES | CCCCCN(C)C(=O)c1ccc(-c2cc(-c3nnc(C)o3)ccc2C)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-5-6-7-14-26(4)23(27)19-12-10-18(11-13-19)21-15-20(9-8-16(21)2)22-25-24-17(3)28-22/h8-13,15H,5-7,14H2,1-4H3 |
| InChIKey | CPJSLDPSWUJWCG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|