C19H13Cl3N2O4 — CID 86597648
4-[2-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]benzoyl chloride;oxalyl dichloride (PubChem CID 86597648) has the molecular formula C19H13Cl3N2O4 and a molecular weight of 439.68 g/mol. Its IUPAC name is 4-[2-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]benzoyl chloride;oxalyl dichloride.
| Compound Name | 4-[2-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]benzoyl chloride;oxalyl dichloride |
|---|---|
| PubChem CID | 86597648 |
| Molecular Formula | C19H13Cl3N2O4 |
| Molecular Weight | 439.68 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 4-[2-methyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]benzoyl chloride;oxalyl dichloride |
| SMILES | Cc1nnc(-c2ccc(C)c(-c3ccc(C(=O)Cl)cc3)c2)o1.O=C(Cl)C(=O)Cl |
| InChI | InChI=1S/C17H13ClN2O2.C2Cl2O2/c1-10-3-4-14(17-20-19-11(2)22-17)9-15(10)12-5-7-13(8-6-12)16(18)21;3-1(5)2(4)6/h3-9H,1-2H3; |
| InChIKey | PXSATMITTQYZFX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 90.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|