C19H14Cl2F3N5O2 — CID 21080623
2-N-(3,4-dichlorophenyl)-4-N-methyl-4-N-[(2-nitrophenyl)methyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 21080623) has the molecular formula C19H14Cl2F3N5O2 and a molecular weight of 472.25 g/mol. Its IUPAC name is 2-N-(3,4-dichlorophenyl)-4-N-methyl-4-N-[(2-nitrophenyl)methyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3,4-dichlorophenyl)-4-N-methyl-4-N-[(2-nitrophenyl)methyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 21080623 |
| Molecular Formula | C19H14Cl2F3N5O2 |
| Molecular Weight | 472.25 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 2-N-(3,4-dichlorophenyl)-4-N-methyl-4-N-[(2-nitrophenyl)methyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CN(Cc1ccccc1[N+](=O)[O-])c1nc(Nc2ccc(Cl)c(Cl)c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C19H14Cl2F3N5O2/c1-28(10-11-4-2-3-5-16(11)29(30)31)17-13(19(22,23)24)9-25-18(27-17)26-12-6-7-14(20)15(21)8-12/h2-9H,10H2,1H3,(H,25,26,27) |
| InChIKey | PBGHWPVHMFDWLD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.25 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|