C17H20ClN2O+ — CID 2108164
[(1R)-2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]-dimethylazanium (PubChem CID 2108164) has the molecular formula C17H20ClN2O+ and a molecular weight of 303.81 g/mol. Its IUPAC name is [(1R)-2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]-dimethylazanium.
| Compound Name | [(1R)-2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 2108164 |
| Molecular Formula | C17H20ClN2O+ |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | [(1R)-2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]-dimethylazanium |
| SMILES | Cc1ccc(NC(=O)[C@@H](c2ccccc2)[NH+](C)C)cc1Cl |
| InChI | InChI=1S/C17H19ClN2O/c1-12-9-10-14(11-15(12)18)19-17(21)16(20(2)3)13-7-5-4-6-8-13/h4-11,16H,1-3H3,(H,19,21)/p+1/t16-/m1/s1 |
| InChIKey | VZRHZZJQPVOEMN-MRXNPFEDSA-O |
| XLogP | 2.47 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |