C20H21N3OS — CID 2108386
3-benzyl-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-phenylthiourea (PubChem CID 2108386) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is 3-benzyl-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-phenylthiourea.
| Compound Name | 3-benzyl-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-phenylthiourea |
|---|---|
| PubChem CID | 2108386 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 3-benzyl-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-phenylthiourea |
| SMILES | Cc1noc(C)c1CN(C(=S)NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21N3OS/c1-15-19(16(2)24-22-15)14-23(18-11-7-4-8-12-18)20(25)21-13-17-9-5-3-6-10-17/h3-12H,13-14H2,1-2H3,(H,21,25) |
| InChIKey | WDZNMINAXGAERF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|