C22H19N3O3S — CID 21083978
1-(2-hydroxyethyl)-3-(6-oxo-3,7-diphenylthieno[2,3-b]pyridin-2-yl)urea (PubChem CID 21083978) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(6-oxo-3,7-diphenylthieno[2,3-b]pyridin-2-yl)urea.
| Compound Name | 1-(2-hydroxyethyl)-3-(6-oxo-3,7-diphenylthieno[2,3-b]pyridin-2-yl)urea |
|---|---|
| PubChem CID | 21083978 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(6-oxo-3,7-diphenylthieno[2,3-b]pyridin-2-yl)urea |
| SMILES | O=C(NCCO)Nc1sc2c(ccc(=O)n2-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H19N3O3S/c26-14-13-23-22(28)24-20-19(15-7-3-1-4-8-15)17-11-12-18(27)25(21(17)29-20)16-9-5-2-6-10-16/h1-12,26H,13-14H2,(H2,23,24,28) |
| InChIKey | XUSCHAXNZSJAIM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |