C15H18N2O4 — CID 21084211
N-hydroxy-2-(4-methoxybenzoyl)-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 21084211) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-hydroxy-2-(4-methoxybenzoyl)-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | N-hydroxy-2-(4-methoxybenzoyl)-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 21084211 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-hydroxy-2-(4-methoxybenzoyl)-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | COc1ccc(C(=O)N2C3CCC(C3)C2C(=O)NO)cc1 |
| InChI | InChI=1S/C15H18N2O4/c1-21-12-6-3-9(4-7-12)15(19)17-11-5-2-10(8-11)13(17)14(18)16-20/h3-4,6-7,10-11,13,20H,2,5,8H2,1H3,(H,16,18) |
| InChIKey | AWLUDZXHRHTNKC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|