C22H33N5O9S — CID 176810047
2-methoxyethyl (1S,2R,5R)-2-(hydroxycarbamoyl)-3-[4-(4-methoxyphenoxy)piperazin-1-yl]sulfonyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 176810047) has the molecular formula C22H33N5O9S and a molecular weight of 543.60 g/mol. Its IUPAC name is 2-methoxyethyl (1S,2R,5R)-2-(hydroxycarbamoyl)-3-[4-(4-methoxyphenoxy)piperazin-1-yl]sulfonyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | 2-methoxyethyl (1S,2R,5R)-2-(hydroxycarbamoyl)-3-[4-(4-methoxyphenoxy)piperazin-1-yl]sulfonyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 176810047 |
| Molecular Formula | C22H33N5O9S |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 2-methoxyethyl (1S,2R,5R)-2-(hydroxycarbamoyl)-3-[4-(4-methoxyphenoxy)piperazin-1-yl]sulfonyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COCCOC(=O)N1[C@@H]2CC[C@H]1[C@H](C(=O)NO)N(S(=O)(=O)N1CCN(Oc3ccc(OC)cc3)CC1)C2 |
| InChI | InChI=1S/C22H33N5O9S/c1-33-13-14-35-22(29)27-16-3-8-19(27)20(21(28)23-30)26(15-16)37(31,32)25-11-9-24(10-12-25)36-18-6-4-17(34-2)5-7-18/h4-7,16,19-20,30H,3,8-15H2,1-2H3,(H,23,28)/t16-,19+,20-/m1/s1 |
| InChIKey | WOIIYGMVWBICOW-LSTHTHJFSA-N |
| XLogP | -0.34 |
| TPSA | 150.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|