C21H28N6O8S — CID 176810096
2-methoxyethyl (1S,2R,5R)-3-[[6-(1-ethylpyrazol-4-yl)oxy-3-pyridinyl]sulfonyl]-2-(hydroxycarbamoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 176810096) has the molecular formula C21H28N6O8S and a molecular weight of 524.56 g/mol. Its IUPAC name is 2-methoxyethyl (1S,2R,5R)-3-[[6-(1-ethylpyrazol-4-yl)oxy-3-pyridinyl]sulfonyl]-2-(hydroxycarbamoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | 2-methoxyethyl (1S,2R,5R)-3-[[6-(1-ethylpyrazol-4-yl)oxy-3-pyridinyl]sulfonyl]-2-(hydroxycarbamoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 176810096 |
| Molecular Formula | C21H28N6O8S |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 2-methoxyethyl (1S,2R,5R)-3-[[6-(1-ethylpyrazol-4-yl)oxy-3-pyridinyl]sulfonyl]-2-(hydroxycarbamoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCn1cc(Oc2ccc(S(=O)(=O)N3C[C@H]4CC[C@@H]([C@@H]3C(=O)NO)N4C(=O)OCCOC)cn2)cn1 |
| InChI | InChI=1S/C21H28N6O8S/c1-3-25-13-15(10-23-25)35-18-7-5-16(11-22-18)36(31,32)26-12-14-4-6-17(19(26)20(28)24-30)27(14)21(29)34-9-8-33-2/h5,7,10-11,13-14,17,19,30H,3-4,6,8-9,12H2,1-2H3,(H,24,28)/t14-,17+,19-/m1/s1 |
| InChIKey | BVKCHRSVSGDIKN-DKSSEZFCSA-N |
| XLogP | 0.58 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|