C29H41ClFN3O11S — CID 169209267
3-O-ethyl 1-O-(2-methoxyethyl) (2S,3S)-2-ethyl-4-[[6-(4-fluorophenoxy)-3-pyridinyl]sulfonyl]piperazine-1,3-dicarboxylate;methane;2-methoxyethyl carbonochloridate (PubChem CID 169209267) has the molecular formula C29H41ClFN3O11S and a molecular weight of 694.18 g/mol. Its IUPAC name is 3-O-ethyl 1-O-(2-methoxyethyl) (2S,3S)-2-ethyl-4-[[6-(4-fluorophenoxy)-3-pyridinyl]sulfonyl]piperazine-1,3-dicarboxylate;methane;2-methoxyethyl carbonochloridate.
| Compound Name | 3-O-ethyl 1-O-(2-methoxyethyl) (2S,3S)-2-ethyl-4-[[6-(4-fluorophenoxy)-3-pyridinyl]sulfonyl]piperazine-1,3-dicarboxylate;methane;2-methoxyethyl carbonochloridate |
|---|---|
| PubChem CID | 169209267 |
| Molecular Formula | C29H41ClFN3O11S |
| Molecular Weight | 694.18 g/mol |
| Exact Mass | 693.21 |
| IUPAC Name | 3-O-ethyl 1-O-(2-methoxyethyl) (2S,3S)-2-ethyl-4-[[6-(4-fluorophenoxy)-3-pyridinyl]sulfonyl]piperazine-1,3-dicarboxylate;methane;2-methoxyethyl carbonochloridate |
| SMILES | C.CCOC(=O)[C@@H]1[C@H](CC)N(C(=O)OCCOC)CCN1S(=O)(=O)c1ccc(Oc2ccc(F)cc2)nc1.COCCOC(=O)Cl |
| InChI | InChI=1S/C24H30FN3O8S.C4H7ClO3.CH4/c1-4-20-22(23(29)34-5-2)28(13-12-27(20)24(30)35-15-14-33-3)37(31,32)19-10-11-21(26-16-19)36-18-8-6-17(25)7-9-18;1-7-2-3-8-4(5)6;/h6-11,16,20,22H,4-5,12-15H2,1-3H3;2-3H2,1H3;1H4/t20-,22-;;/m0../s1 |
| InChIKey | JFAZJHRBFVRQOL-HWELVIDPSA-N |
| XLogP | 4.46 |
| TPSA | 160.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.18 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|