C24H28FN5O8S — CID 176810122
(1S,2R,5R)-3-[[6-(3-fluoro-4-methoxyphenoxy)-3-pyridinyl]sulfonyl]-N-hydroxy-8-(morpholine-4-carbonyl)-3,8-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 176810122) has the molecular formula C24H28FN5O8S and a molecular weight of 565.58 g/mol. Its IUPAC name is (1S,2R,5R)-3-[[6-(3-fluoro-4-methoxyphenoxy)-3-pyridinyl]sulfonyl]-N-hydroxy-8-(morpholine-4-carbonyl)-3,8-diazabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (1S,2R,5R)-3-[[6-(3-fluoro-4-methoxyphenoxy)-3-pyridinyl]sulfonyl]-N-hydroxy-8-(morpholine-4-carbonyl)-3,8-diazabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 176810122 |
| Molecular Formula | C24H28FN5O8S |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | (1S,2R,5R)-3-[[6-(3-fluoro-4-methoxyphenoxy)-3-pyridinyl]sulfonyl]-N-hydroxy-8-(morpholine-4-carbonyl)-3,8-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)N3C[C@H]4CC[C@@H]([C@@H]3C(=O)NO)N4C(=O)N3CCOCC3)cn2)cc1F |
| InChI | InChI=1S/C24H28FN5O8S/c1-36-20-6-3-16(12-18(20)25)38-21-7-4-17(13-26-21)39(34,35)29-14-15-2-5-19(22(29)23(31)27-33)30(15)24(32)28-8-10-37-11-9-28/h3-4,6-7,12-13,15,19,22,33H,2,5,8-11,14H2,1H3,(H,27,31)/t15-,19+,22-/m1/s1 |
| InChIKey | UHHBPUMBJDCGQV-QOEFQVSFSA-N |
| XLogP | 1.19 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|