C24H34N2O5S — CID 21087085
N-[3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-5-methylsulfonylpentanamide (PubChem CID 21087085) has the molecular formula C24H34N2O5S and a molecular weight of 462.61 g/mol. Its IUPAC name is N-[3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-5-methylsulfonylpentanamide.
| Compound Name | N-[3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-5-methylsulfonylpentanamide |
|---|---|
| PubChem CID | 21087085 |
| Molecular Formula | C24H34N2O5S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-[3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-5-methylsulfonylpentanamide |
| SMILES | COc1cccc(CNCC(O)C(Cc2ccccc2)NC(=O)CCCCS(C)(=O)=O)c1 |
| InChI | InChI=1S/C24H34N2O5S/c1-31-21-12-8-11-20(15-21)17-25-18-23(27)22(16-19-9-4-3-5-10-19)26-24(28)13-6-7-14-32(2,29)30/h3-5,8-12,15,22-23,25,27H,6-7,13-14,16-18H2,1-2H3,(H,26,28) |
| InChIKey | DDDXMRRRIIOHMB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|