C27H32N4O3 — CID 68609883
2-[[amino(phenyl)methylidene]amino]-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]acetamide (PubChem CID 68609883) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-[[amino(phenyl)methylidene]amino]-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]acetamide.
| Compound Name | 2-[[amino(phenyl)methylidene]amino]-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 68609883 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 2-[[amino(phenyl)methylidene]amino]-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]acetamide |
| SMILES | COc1cccc(CNC[C@@H](O)[C@H](Cc2ccccc2)NC(=O)C/N=C(\N)c2ccccc2)c1 |
| InChI | InChI=1S/C27H32N4O3/c1-34-23-14-8-11-21(15-23)17-29-18-25(32)24(16-20-9-4-2-5-10-20)31-26(33)19-30-27(28)22-12-6-3-7-13-22/h2-15,24-25,29,32H,16-19H2,1H3,(H2,28,30)(H,31,33)/t24-,25+/m0/s1 |
| InChIKey | JGJUUMNNVZRPQA-LOSJGSFVSA-N |
| XLogP | 2.28 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|