C24H24ClN5OS2 — CID 2108760
2-[[5-(2-chlorophenyl)-4-cyclopentyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2108760) has the molecular formula C24H24ClN5OS2 and a molecular weight of 498.08 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-4-cyclopentyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[5-(2-chlorophenyl)-4-cyclopentyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2108760 |
| Molecular Formula | C24H24ClN5OS2 |
| Molecular Weight | 498.08 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-4-cyclopentyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CSc2nnc(-c3ccccc3Cl)n2C2CCCC2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C24H24ClN5OS2/c25-17-11-5-3-9-15(17)21-28-29-24(30(21)14-7-1-2-8-14)32-13-19-26-22(31)20-16-10-4-6-12-18(16)33-23(20)27-19/h3,5,9,11,14H,1-2,4,6-8,10,12-13H2,(H,26,27,31) |
| InChIKey | VNISIBGGVNNUDD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.08 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |