C23H15F3N2O5S — CID 2109013
2-oxo-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]chromene-3-carboxamide (PubChem CID 2109013) has the molecular formula C23H15F3N2O5S and a molecular weight of 488.44 g/mol. Its IUPAC name is 2-oxo-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]chromene-3-carboxamide.
| Compound Name | 2-oxo-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 2109013 |
| Molecular Formula | C23H15F3N2O5S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 2-oxo-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]chromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C23H15F3N2O5S/c24-23(25,26)15-5-3-6-17(13-15)28-34(31,32)18-10-8-16(9-11-18)27-21(29)19-12-14-4-1-2-7-20(14)33-22(19)30/h1-13,28H,(H,27,29) |
| InChIKey | IJUCYMFFSLPWDK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|