C22H29N3O4 — CID 21090321
tert-butyl 3-[(6-oxo-4-phenylmethoxypyrimidin-1-yl)methyl]piperidine-1-carboxylate (PubChem CID 21090321) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is tert-butyl 3-[(6-oxo-4-phenylmethoxypyrimidin-1-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-oxo-4-phenylmethoxypyrimidin-1-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 21090321 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | tert-butyl 3-[(6-oxo-4-phenylmethoxypyrimidin-1-yl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Cn2cnc(OCc3ccccc3)cc2=O)C1 |
| InChI | InChI=1S/C22H29N3O4/c1-22(2,3)29-21(27)24-11-7-10-18(13-24)14-25-16-23-19(12-20(25)26)28-15-17-8-5-4-6-9-17/h4-6,8-9,12,16,18H,7,10-11,13-15H2,1-3H3 |
| InChIKey | JMZUATJSVDICIS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |