C7H7BrF2N2O — CID 21090408
(2S)-1-(2-bromoacetyl)-4,4-difluoropyrrolidine-2-carbonitrile (PubChem CID 21090408) has the molecular formula C7H7BrF2N2O and a molecular weight of 253.05 g/mol. Its IUPAC name is (2S)-1-(2-bromoacetyl)-4,4-difluoropyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-(2-bromoacetyl)-4,4-difluoropyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 21090408 |
| Molecular Formula | C7H7BrF2N2O |
| Molecular Weight | 253.05 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | (2S)-1-(2-bromoacetyl)-4,4-difluoropyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CC(F)(F)CN1C(=O)CBr |
| InChI | InChI=1S/C7H7BrF2N2O/c8-2-6(13)12-4-7(9,10)1-5(12)3-11/h5H,1-2,4H2/t5-/m0/s1 |
| InChIKey | VWFGWJBXTCDVIG-YFKPBYRVSA-N |
| XLogP | 1.14 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.05 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|