C16H24N2O5 — CID 21091421
3-(2-aminophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 21091421) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-(2-aminophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | 3-(2-aminophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 21091421 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-(2-aminophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | CCC(Oc1ccccc1N)C(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H24N2O5/c1-5-11(22-12-9-7-6-8-10(12)17)13(14(19)20)18-15(21)23-16(2,3)4/h6-9,11,13H,5,17H2,1-4H3,(H,18,21)(H,19,20) |
| InChIKey | WODLHBOGUMYJQC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|