C25H27FN4O4 — CID 21100642
2-[5-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-6-methoxy-1H-indol-3-yl]-2-oxoacetamide (PubChem CID 21100642) has the molecular formula C25H27FN4O4 and a molecular weight of 466.51 g/mol. Its IUPAC name is 2-[5-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-6-methoxy-1H-indol-3-yl]-2-oxoacetamide.
| Compound Name | 2-[5-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-6-methoxy-1H-indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 21100642 |
| Molecular Formula | C25H27FN4O4 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 2-[5-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-6-methoxy-1H-indol-3-yl]-2-oxoacetamide |
| SMILES | COc1cc2[nH]cc(C(=O)C(N)=O)c2cc1C(=O)N1C[C@H](C)N(Cc2ccc(F)cc2)C[C@H]1C |
| InChI | InChI=1S/C25H27FN4O4/c1-14-12-30(15(2)11-29(14)13-16-4-6-17(26)7-5-16)25(33)19-8-18-20(23(31)24(27)32)10-28-21(18)9-22(19)34-3/h4-10,14-15,28H,11-13H2,1-3H3,(H2,27,32)/t14-,15+/m0/s1 |
| InChIKey | FCLSFPSLJCTMHO-LSDHHAIUSA-N |
| XLogP | 2.72 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|