C26H30N4O4 — CID 163736072
2-[5-(4-benzyl-2-methylpiperazine-1-carbonyl)-6-methoxy-1H-indol-3-yl]-N,N-dimethyl-2-oxoacetamide (PubChem CID 163736072) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[5-(4-benzyl-2-methylpiperazine-1-carbonyl)-6-methoxy-1H-indol-3-yl]-N,N-dimethyl-2-oxoacetamide.
| Compound Name | 2-[5-(4-benzyl-2-methylpiperazine-1-carbonyl)-6-methoxy-1H-indol-3-yl]-N,N-dimethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 163736072 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-[5-(4-benzyl-2-methylpiperazine-1-carbonyl)-6-methoxy-1H-indol-3-yl]-N,N-dimethyl-2-oxoacetamide |
| SMILES | COc1cc2[nH]cc(C(=O)C(=O)N(C)C)c2cc1C(=O)N1CCN(Cc2ccccc2)CC1C |
| InChI | InChI=1S/C26H30N4O4/c1-17-15-29(16-18-8-6-5-7-9-18)10-11-30(17)25(32)20-12-19-21(24(31)26(33)28(2)3)14-27-22(19)13-23(20)34-4/h5-9,12-14,17,27H,10-11,15-16H2,1-4H3 |
| InChIKey | LDSCMCNUTHUSRK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|