C25H28Cl2N4O3 — CID 142871804
2-[6-chloro-5-[4-[(3-chlorophenyl)methyl]-2-methylpiperazine-1-carbonyl]-1H-indol-3-yl]-2-oxoacetamide;ethane (PubChem CID 142871804) has the molecular formula C25H28Cl2N4O3 and a molecular weight of 503.43 g/mol. Its IUPAC name is 2-[6-chloro-5-[4-[(3-chlorophenyl)methyl]-2-methylpiperazine-1-carbonyl]-1H-indol-3-yl]-2-oxoacetamide;ethane.
| Compound Name | 2-[6-chloro-5-[4-[(3-chlorophenyl)methyl]-2-methylpiperazine-1-carbonyl]-1H-indol-3-yl]-2-oxoacetamide;ethane |
|---|---|
| PubChem CID | 142871804 |
| Molecular Formula | C25H28Cl2N4O3 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 2-[6-chloro-5-[4-[(3-chlorophenyl)methyl]-2-methylpiperazine-1-carbonyl]-1H-indol-3-yl]-2-oxoacetamide;ethane |
| SMILES | CC.CC1CN(Cc2cccc(Cl)c2)CCN1C(=O)c1cc2c(C(=O)C(N)=O)c[nH]c2cc1Cl |
| InChI | InChI=1S/C23H22Cl2N4O3.C2H6/c1-13-11-28(12-14-3-2-4-15(24)7-14)5-6-29(13)23(32)17-8-16-18(21(30)22(26)31)10-27-20(16)9-19(17)25;1-2/h2-4,7-10,13,27H,5-6,11-12H2,1H3,(H2,26,31);1-2H3 |
| InChIKey | ODZYVWNYGCORJP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|