C32H33ClN4O3 — CID 142871738
2-[5-[(5S)-4-benzhydryl-2,5-dimethylpiperazine-1-carbonyl]-6-chloro-1H-indol-3-yl]-N,N-dimethyl-2-oxoacetamide (PubChem CID 142871738) has the molecular formula C32H33ClN4O3 and a molecular weight of 557.09 g/mol. Its IUPAC name is 2-[5-[(5S)-4-benzhydryl-2,5-dimethylpiperazine-1-carbonyl]-6-chloro-1H-indol-3-yl]-N,N-dimethyl-2-oxoacetamide.
| Compound Name | 2-[5-[(5S)-4-benzhydryl-2,5-dimethylpiperazine-1-carbonyl]-6-chloro-1H-indol-3-yl]-N,N-dimethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 142871738 |
| Molecular Formula | C32H33ClN4O3 |
| Molecular Weight | 557.09 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 2-[5-[(5S)-4-benzhydryl-2,5-dimethylpiperazine-1-carbonyl]-6-chloro-1H-indol-3-yl]-N,N-dimethyl-2-oxoacetamide |
| SMILES | CC1CN(C(c2ccccc2)c2ccccc2)[C@@H](C)CN1C(=O)c1cc2c(C(=O)C(=O)N(C)C)c[nH]c2cc1Cl |
| InChI | InChI=1S/C32H33ClN4O3/c1-20-19-37(21(2)18-36(20)29(22-11-7-5-8-12-22)23-13-9-6-10-14-23)31(39)25-15-24-26(30(38)32(40)35(3)4)17-34-28(24)16-27(25)33/h5-17,20-21,29,34H,18-19H2,1-4H3/t20-,21?/m0/s1 |
| InChIKey | FIHMDGOMZOGPMU-BGERDNNASA-N |
| XLogP | 5.42 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.09 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|