C29H36N4O3 — CID 153313411
2-[5-[2,5-dimethyl-4-(1-phenylethyl)piperazine-1-carbonyl]-4-ethyl-1H-indol-3-yl]-N,N-dimethyl-2-oxoacetamide (PubChem CID 153313411) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is 2-[5-[2,5-dimethyl-4-(1-phenylethyl)piperazine-1-carbonyl]-4-ethyl-1H-indol-3-yl]-N,N-dimethyl-2-oxoacetamide.
| Compound Name | 2-[5-[2,5-dimethyl-4-(1-phenylethyl)piperazine-1-carbonyl]-4-ethyl-1H-indol-3-yl]-N,N-dimethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 153313411 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 2-[5-[2,5-dimethyl-4-(1-phenylethyl)piperazine-1-carbonyl]-4-ethyl-1H-indol-3-yl]-N,N-dimethyl-2-oxoacetamide |
| SMILES | CCc1c(C(=O)N2CC(C)N(C(C)c3ccccc3)CC2C)ccc2[nH]cc(C(=O)C(=O)N(C)C)c12 |
| InChI | InChI=1S/C29H36N4O3/c1-7-22-23(13-14-25-26(22)24(15-30-25)27(34)29(36)31(5)6)28(35)33-17-18(2)32(16-19(33)3)20(4)21-11-9-8-10-12-21/h8-15,18-20,30H,7,16-17H2,1-6H3 |
| InChIKey | KNTULJNWWGMDPZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|