C24H24ClFN4O3 — CID 142871798
2-[6-chloro-5-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazine-1-carbonyl]-1H-indol-3-yl]-N-methyl-2-oxoacetamide (PubChem CID 142871798) has the molecular formula C24H24ClFN4O3 and a molecular weight of 470.93 g/mol. Its IUPAC name is 2-[6-chloro-5-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazine-1-carbonyl]-1H-indol-3-yl]-N-methyl-2-oxoacetamide.
| Compound Name | 2-[6-chloro-5-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazine-1-carbonyl]-1H-indol-3-yl]-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 142871798 |
| Molecular Formula | C24H24ClFN4O3 |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-[6-chloro-5-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazine-1-carbonyl]-1H-indol-3-yl]-N-methyl-2-oxoacetamide |
| SMILES | CNC(=O)C(=O)c1c[nH]c2cc(Cl)c(C(=O)N3CCN(Cc4ccc(F)cc4)C[C@H]3C)cc12 |
| InChI | InChI=1S/C24H24ClFN4O3/c1-14-12-29(13-15-3-5-16(26)6-4-15)7-8-30(14)24(33)18-9-17-19(22(31)23(32)27-2)11-28-21(17)10-20(18)25/h3-6,9-11,14,28H,7-8,12-13H2,1-2H3,(H,27,32)/t14-/m1/s1 |
| InChIKey | UCNNTWYJLLGJRE-CQSZACIVSA-N |
| XLogP | 3.24 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|