C24H28N4 — CID 142871654
1-[5-[1-(4-benzyl-2-methylpiperazin-1-yl)ethenyl]-1H-indol-3-yl]ethenamine (PubChem CID 142871654) has the molecular formula C24H28N4 and a molecular weight of 372.52 g/mol. Its IUPAC name is 1-[5-[1-(4-benzyl-2-methylpiperazin-1-yl)ethenyl]-1H-indol-3-yl]ethenamine.
| Compound Name | 1-[5-[1-(4-benzyl-2-methylpiperazin-1-yl)ethenyl]-1H-indol-3-yl]ethenamine |
|---|---|
| PubChem CID | 142871654 |
| Molecular Formula | C24H28N4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-[5-[1-(4-benzyl-2-methylpiperazin-1-yl)ethenyl]-1H-indol-3-yl]ethenamine |
| SMILES | C=C(N)c1c[nH]c2ccc(C(=C)N3CCN(Cc4ccccc4)CC3C)cc12 |
| InChI | InChI=1S/C24H28N4/c1-17-15-27(16-20-7-5-4-6-8-20)11-12-28(17)19(3)21-9-10-24-22(13-21)23(14-26-24)18(2)25/h4-10,13-14,17,26H,2-3,11-12,15-16,25H2,1H3 |
| InChIKey | ONGDFVXXQSHZON-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |