C23H21Cl2MnN5 — CID 21107923
N,N-bis(1H-benzimidazol-2-ylmethyl)-1-phenylmethanamine;dichloromanganese (PubChem CID 21107923) has the molecular formula C23H21Cl2MnN5 and a molecular weight of 493.30 g/mol. Its IUPAC name is N,N-bis(1H-benzimidazol-2-ylmethyl)-1-phenylmethanamine;dichloromanganese.
| Compound Name | N,N-bis(1H-benzimidazol-2-ylmethyl)-1-phenylmethanamine;dichloromanganese |
|---|---|
| PubChem CID | 21107923 |
| Molecular Formula | C23H21Cl2MnN5 |
| Molecular Weight | 493.30 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | N,N-bis(1H-benzimidazol-2-ylmethyl)-1-phenylmethanamine;dichloromanganese |
| SMILES | Cl[Mn]Cl.c1ccc(CN(Cc2nc3ccccc3[nH]2)Cc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C23H21N5.2ClH.Mn/c1-2-8-17(9-3-1)14-28(15-22-24-18-10-4-5-11-19(18)25-22)16-23-26-20-12-6-7-13-21(20)27-23;;;/h1-13H,14-16H2,(H,24,25)(H,26,27);2*1H;/q;;;+2/p-2 |
| InChIKey | UPLPIMCRYIWOPV-UHFFFAOYSA-L |
| XLogP | 6.02 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.30 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |