C23H21Cl3CrN5+ — CID 91865506
N,N-bis(1H-benzimidazol-2-ylmethyl)-1-phenylmethanamine;trichlorochromium(1+) (PubChem CID 91865506) has the molecular formula C23H21Cl3CrN5+ and a molecular weight of 525.81 g/mol. Its IUPAC name is N,N-bis(1H-benzimidazol-2-ylmethyl)-1-phenylmethanamine;trichlorochromium(1+).
| Compound Name | N,N-bis(1H-benzimidazol-2-ylmethyl)-1-phenylmethanamine;trichlorochromium(1+) |
|---|---|
| PubChem CID | 91865506 |
| Molecular Formula | C23H21Cl3CrN5+ |
| Molecular Weight | 525.81 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | N,N-bis(1H-benzimidazol-2-ylmethyl)-1-phenylmethanamine;trichlorochromium(1+) |
| SMILES | Cl[Cr+](Cl)Cl.c1ccc(CN(Cc2nc3ccccc3[nH]2)Cc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C23H21N5.3ClH.Cr/c1-2-8-17(9-3-1)14-28(15-22-24-18-10-4-5-11-19(18)25-22)16-23-26-20-12-6-7-13-21(20)27-23;;;;/h1-13H,14-16H2,(H,24,25)(H,26,27);3*1H;/q;;;;+4/p-3 |
| InChIKey | VYFNMJXPDPCKLX-UHFFFAOYSA-K |
| XLogP | 6.71 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.81 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |