C28H34N2O7S — CID 21108209
butanedioic acid;3-(4-naphthalen-2-ylsulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl)-N-propylpropan-1-amine (PubChem CID 21108209) has the molecular formula C28H34N2O7S and a molecular weight of 542.65 g/mol. Its IUPAC name is butanedioic acid;3-(4-naphthalen-2-ylsulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl)-N-propylpropan-1-amine.
| Compound Name | butanedioic acid;3-(4-naphthalen-2-ylsulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 21108209 |
| Molecular Formula | C28H34N2O7S |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | butanedioic acid;3-(4-naphthalen-2-ylsulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl)-N-propylpropan-1-amine |
| SMILES | CCCNCCCc1ccc2c(c1)N(S(=O)(=O)c1ccc3ccccc3c1)CCO2.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C24H28N2O3S.C4H6O4/c1-2-13-25-14-5-6-19-9-12-24-23(17-19)26(15-16-29-24)30(27,28)22-11-10-20-7-3-4-8-21(20)18-22;5-3(6)1-2-4(7)8/h3-4,7-12,17-18,25H,2,5-6,13-16H2,1H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | HNKLYMFADPDOSS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|