C23H25Br2N5O2 — CID 21109789
3-[1-[1-(4-amino-3,5-dibromobenzoyl)azetidin-3-yl]piperidin-4-yl]-1,4-dihydroquinazolin-2-one (PubChem CID 21109789) has the molecular formula C23H25Br2N5O2 and a molecular weight of 563.29 g/mol. Its IUPAC name is 3-[1-[1-(4-amino-3,5-dibromobenzoyl)azetidin-3-yl]piperidin-4-yl]-1,4-dihydroquinazolin-2-one.
| Compound Name | 3-[1-[1-(4-amino-3,5-dibromobenzoyl)azetidin-3-yl]piperidin-4-yl]-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 21109789 |
| Molecular Formula | C23H25Br2N5O2 |
| Molecular Weight | 563.29 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | 3-[1-[1-(4-amino-3,5-dibromobenzoyl)azetidin-3-yl]piperidin-4-yl]-1,4-dihydroquinazolin-2-one |
| SMILES | Nc1c(Br)cc(C(=O)N2CC(N3CCC(N4Cc5ccccc5NC4=O)CC3)C2)cc1Br |
| InChI | InChI=1S/C23H25Br2N5O2/c24-18-9-15(10-19(25)21(18)26)22(31)29-12-17(13-29)28-7-5-16(6-8-28)30-11-14-3-1-2-4-20(14)27-23(30)32/h1-4,9-10,16-17H,5-8,11-13,26H2,(H,27,32) |
| InChIKey | HGXRVJMBFAXNIB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|