C15H23N3O2 — CID 145302295
ethane;3-(1-hydroxypiperidin-4-yl)-1,4-dihydroquinazolin-2-one (PubChem CID 145302295) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is ethane;3-(1-hydroxypiperidin-4-yl)-1,4-dihydroquinazolin-2-one.
| Compound Name | ethane;3-(1-hydroxypiperidin-4-yl)-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 145302295 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | ethane;3-(1-hydroxypiperidin-4-yl)-1,4-dihydroquinazolin-2-one |
| SMILES | CC.O=C1Nc2ccccc2CN1C1CCN(O)CC1 |
| InChI | InChI=1S/C13H17N3O2.C2H6/c17-13-14-12-4-2-1-3-10(12)9-16(13)11-5-7-15(18)8-6-11;1-2/h1-4,11,18H,5-9H2,(H,14,17);1-2H3 |
| InChIKey | BSFMZCNXQFDIEV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |