C17H21N3O3 — CID 87696645
4-oxo-4-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]butanal (PubChem CID 87696645) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 4-oxo-4-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]butanal.
| Compound Name | 4-oxo-4-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]butanal |
|---|---|
| PubChem CID | 87696645 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 4-oxo-4-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]butanal |
| SMILES | O=CCCC(=O)N1CCC(N2Cc3ccccc3NC2=O)CC1 |
| InChI | InChI=1S/C17H21N3O3/c21-11-3-6-16(22)19-9-7-14(8-10-19)20-12-13-4-1-2-5-15(13)18-17(20)23/h1-2,4-5,11,14H,3,6-10,12H2,(H,18,23) |
| InChIKey | WBUHWSJBNAWYNX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|