C31H37N3O3 — CID 21109795
1-(1,2,3,4,5,6,7,8-octahydrophenanthren-9-yl)-4-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]butane-1,4-dione (PubChem CID 21109795) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 1-(1,2,3,4,5,6,7,8-octahydrophenanthren-9-yl)-4-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]butane-1,4-dione.
| Compound Name | 1-(1,2,3,4,5,6,7,8-octahydrophenanthren-9-yl)-4-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 21109795 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 1-(1,2,3,4,5,6,7,8-octahydrophenanthren-9-yl)-4-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]butane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCC(N2Cc3ccccc3NC2=O)CC1)c1cc2c(c3c1CCCC3)CCCC2 |
| InChI | InChI=1S/C31H37N3O3/c35-29(27-19-21-7-1-3-9-24(21)25-10-4-5-11-26(25)27)13-14-30(36)33-17-15-23(16-18-33)34-20-22-8-2-6-12-28(22)32-31(34)37/h2,6,8,12,19,23H,1,3-5,7,9-11,13-18,20H2,(H,32,37) |
| InChIKey | AKORNLVCGKMSRU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |