C27H25N3O3 — CID 21109880
(E)-1-naphthalen-1-yl-4-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]but-2-ene-1,4-dione (PubChem CID 21109880) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is (E)-1-naphthalen-1-yl-4-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]but-2-ene-1,4-dione.
| Compound Name | (E)-1-naphthalen-1-yl-4-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 21109880 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | (E)-1-naphthalen-1-yl-4-[4-(2-oxo-1,4-dihydroquinazolin-3-yl)piperidin-1-yl]but-2-ene-1,4-dione |
| SMILES | O=C(/C=C/C(=O)N1CCC(N2Cc3ccccc3NC2=O)CC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H25N3O3/c31-25(23-10-5-8-19-6-1-3-9-22(19)23)12-13-26(32)29-16-14-21(15-17-29)30-18-20-7-2-4-11-24(20)28-27(30)33/h1-13,21H,14-18H2,(H,28,33)/b13-12+ |
| InChIKey | AUZHEOMMFVEBHH-OUKQBFOZSA-N |
| XLogP | 4.62 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|