C15H21N3O3 — CID 67318866
3-piperidin-1-ium-4-yl-1,4-dihydroquinazolin-2-one acetate (PubChem CID 67318866) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-piperidin-1-ium-4-yl-1,4-dihydroquinazolin-2-one acetate.
| Compound Name | 3-piperidin-1-ium-4-yl-1,4-dihydroquinazolin-2-one acetate |
|---|---|
| PubChem CID | 67318866 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-piperidin-1-ium-4-yl-1,4-dihydroquinazolin-2-one acetate |
| SMILES | CC(=O)[O-].O=C1Nc2ccccc2CN1C1CC[NH2+]CC1 |
| InChI | InChI=1S/C13H17N3O.C2H4O2/c17-13-15-12-4-2-1-3-10(12)9-16(13)11-5-7-14-8-6-11;1-2(3)4/h1-4,11,14H,5-9H2,(H,15,17);1H3,(H,3,4) |
| InChIKey | YZHCOAVEPYWBHZ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |