C15H17N3O2S — CID 2111038
3-(1,3-benzothiazol-2-ylmethyl)-5,5-diethylimidazolidine-2,4-dione (PubChem CID 2111038) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylmethyl)-5,5-diethylimidazolidine-2,4-dione.
| Compound Name | 3-(1,3-benzothiazol-2-ylmethyl)-5,5-diethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2111038 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylmethyl)-5,5-diethylimidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(Cc2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C15H17N3O2S/c1-3-15(4-2)13(19)18(14(20)17-15)9-12-16-10-7-5-6-8-11(10)21-12/h5-8H,3-4,9H2,1-2H3,(H,17,20) |
| InChIKey | HHDDWPKXXIIXLR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|