C24H22N6O — CID 21113109
3-[4-(aminomethyl)phenyl]-1-(2-methylphenyl)-1-(4-pyridin-3-ylpyrimidin-2-yl)urea (PubChem CID 21113109) has the molecular formula C24H22N6O and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-[4-(aminomethyl)phenyl]-1-(2-methylphenyl)-1-(4-pyridin-3-ylpyrimidin-2-yl)urea.
| Compound Name | 3-[4-(aminomethyl)phenyl]-1-(2-methylphenyl)-1-(4-pyridin-3-ylpyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 21113109 |
| Molecular Formula | C24H22N6O |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 3-[4-(aminomethyl)phenyl]-1-(2-methylphenyl)-1-(4-pyridin-3-ylpyrimidin-2-yl)urea |
| SMILES | Cc1ccccc1N(C(=O)Nc1ccc(CN)cc1)c1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C24H22N6O/c1-17-5-2-3-7-22(17)30(24(31)28-20-10-8-18(15-25)9-11-20)23-27-14-12-21(29-23)19-6-4-13-26-16-19/h2-14,16H,15,25H2,1H3,(H,28,31) |
| InChIKey | NGNHDOVGTLCTCL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |