C15H8F3NO — CID 21114820
7-(2,3,4-trifluorophenyl)-1H-quinolin-4-one (PubChem CID 21114820) has the molecular formula C15H8F3NO and a molecular weight of 275.23 g/mol. Its IUPAC name is 7-(2,3,4-trifluorophenyl)-1H-quinolin-4-one.
| Compound Name | 7-(2,3,4-trifluorophenyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 21114820 |
| Molecular Formula | C15H8F3NO |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 7-(2,3,4-trifluorophenyl)-1H-quinolin-4-one |
| SMILES | O=c1cc[nH]c2cc(-c3ccc(F)c(F)c3F)ccc12 |
| InChI | InChI=1S/C15H8F3NO/c16-11-4-3-9(14(17)15(11)18)8-1-2-10-12(7-8)19-6-5-13(10)20/h1-7H,(H,19,20) |
| InChIKey | SIYYUGJLIUFRLD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|