C23H32FN3 — CID 21120550
2-(4-ethylpiperazin-1-yl)-4-(1-fluorocyclohexa-2,4-dien-1-yl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine (PubChem CID 21120550) has the molecular formula C23H32FN3 and a molecular weight of 369.53 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-4-(1-fluorocyclohexa-2,4-dien-1-yl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-4-(1-fluorocyclohexa-2,4-dien-1-yl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine |
|---|---|
| PubChem CID | 21120550 |
| Molecular Formula | C23H32FN3 |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-4-(1-fluorocyclohexa-2,4-dien-1-yl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine |
| SMILES | CCN1CCN(c2cc(C3(F)C=CC=CC3)c3c(n2)CCCCCC3)CC1 |
| InChI | InChI=1S/C23H32FN3/c1-2-26-14-16-27(17-15-26)22-18-20(23(24)12-8-5-9-13-23)19-10-6-3-4-7-11-21(19)25-22/h5,8-9,12,18H,2-4,6-7,10-11,13-17H2,1H3 |
| InChIKey | PDEJOVLHKAKRCU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |