C23H30FN3 — CID 71314128
4-(4-fluorophenyl)-2-[4-(1,1,2,2,2-pentadeuterioethyl)piperazin-1-yl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine (PubChem CID 71314128) has the molecular formula C23H30FN3 and a molecular weight of 372.54 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-[4-(1,1,2,2,2-pentadeuterioethyl)piperazin-1-yl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine.
| Compound Name | 4-(4-fluorophenyl)-2-[4-(1,1,2,2,2-pentadeuterioethyl)piperazin-1-yl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine |
|---|---|
| PubChem CID | 71314128 |
| Molecular Formula | C23H30FN3 |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 4-(4-fluorophenyl)-2-[4-(1,1,2,2,2-pentadeuterioethyl)piperazin-1-yl]-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1CCN(c2cc(-c3ccc(F)cc3)c3c(n2)CCCCCC3)CC1 |
| InChI | InChI=1S/C23H30FN3/c1-2-26-13-15-27(16-14-26)23-17-21(18-9-11-19(24)12-10-18)20-7-5-3-4-6-8-22(20)25-23/h9-12,17H,2-8,13-16H2,1H3/i1D3,2D2 |
| InChIKey | XVGOZDAJGBALKS-ZBJDZAJPSA-N |
| XLogP | 4.69 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |