C7H6Br2N2O4 — CID 21121874
2,3-dibromo-2-(5-nitrofuran-2-yl)propanamide (PubChem CID 21121874) has the molecular formula C7H6Br2N2O4 and a molecular weight of 341.94 g/mol. Its IUPAC name is 2,3-dibromo-2-(5-nitrofuran-2-yl)propanamide.
| Compound Name | 2,3-dibromo-2-(5-nitrofuran-2-yl)propanamide |
|---|---|
| PubChem CID | 21121874 |
| Molecular Formula | C7H6Br2N2O4 |
| Molecular Weight | 341.94 g/mol |
| Exact Mass | 339.87 |
| IUPAC Name | 2,3-dibromo-2-(5-nitrofuran-2-yl)propanamide |
| SMILES | NC(=O)C(Br)(CBr)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C7H6Br2N2O4/c8-3-7(9,6(10)12)4-1-2-5(15-4)11(13)14/h1-2H,3H2,(H2,10,12) |
| InChIKey | GOPXSZCHAZJULJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.94 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|