C15H25N2O3- — CID 21122331
N-oxido-N-(6,10,10-trimethyl-2-methylidene-6-nitroso-5-bicyclo[7.2.0]undecanyl)hydroxylamine (PubChem CID 21122331) has the molecular formula C15H25N2O3- and a molecular weight of 281.38 g/mol. Its IUPAC name is N-oxido-N-(6,10,10-trimethyl-2-methylidene-6-nitroso-5-bicyclo[7.2.0]undecanyl)hydroxylamine.
| Compound Name | N-oxido-N-(6,10,10-trimethyl-2-methylidene-6-nitroso-5-bicyclo[7.2.0]undecanyl)hydroxylamine |
|---|---|
| PubChem CID | 21122331 |
| Molecular Formula | C15H25N2O3- |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-oxido-N-(6,10,10-trimethyl-2-methylidene-6-nitroso-5-bicyclo[7.2.0]undecanyl)hydroxylamine |
| SMILES | C=C1CCC(N([O-])O)C(C)(N=O)CCC2C1CC2(C)C |
| InChI | InChI=1S/C15H25N2O3/c1-10-5-6-13(17(19)20)15(4,16-18)8-7-12-11(10)9-14(12,2)3/h11-13,19H,1,5-9H2,2-4H3/q-1 |
| InChIKey | WUQHIZOYYWFKNT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|