C26H30N2O3 — CID 2112514
[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 3-ethyl-2-propylquinoline-4-carboxylate (PubChem CID 2112514) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 3-ethyl-2-propylquinoline-4-carboxylate.
| Compound Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 3-ethyl-2-propylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2112514 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 3-ethyl-2-propylquinoline-4-carboxylate |
| SMILES | C=CCn1c(C)cc(C(=O)COC(=O)c2c(CC)c(CCC)nc3ccccc23)c1C |
| InChI | InChI=1S/C26H30N2O3/c1-6-11-22-19(8-3)25(20-12-9-10-13-23(20)27-22)26(30)31-16-24(29)21-15-17(4)28(14-7-2)18(21)5/h7,9-10,12-13,15H,2,6,8,11,14,16H2,1,3-5H3 |
| InChIKey | GOZSMWBEJWZCTL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|