C28H27NO4 — CID 23762011
[2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 3-ethyl-2-propylquinoline-4-carboxylate (PubChem CID 23762011) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 3-ethyl-2-propylquinoline-4-carboxylate.
| Compound Name | [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 3-ethyl-2-propylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 23762011 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 3-ethyl-2-propylquinoline-4-carboxylate |
| SMILES | CCCc1nc2ccccc2c(C(=O)OCC(=O)c2ccc3cc(OC)ccc3c2)c1CC |
| InChI | InChI=1S/C28H27NO4/c1-4-8-24-22(5-2)27(23-9-6-7-10-25(23)29-24)28(31)33-17-26(30)20-12-11-19-16-21(32-3)14-13-18(19)15-20/h6-7,9-16H,4-5,8,17H2,1-3H3 |
| InChIKey | PDBUBAREYGAKPV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |