C31H32NO7-3 — CID 21127290
1-(3,3-diphenylprop-2-enyl)-4-phenylpiperidin-4-ol;oxalate;propanoate (PubChem CID 21127290) has the molecular formula C31H32NO7-3 and a molecular weight of 530.60 g/mol. Its IUPAC name is 1-(3,3-diphenylprop-2-enyl)-4-phenylpiperidin-4-ol;oxalate;propanoate.
| Compound Name | 1-(3,3-diphenylprop-2-enyl)-4-phenylpiperidin-4-ol;oxalate;propanoate |
|---|---|
| PubChem CID | 21127290 |
| Molecular Formula | C31H32NO7-3 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 1-(3,3-diphenylprop-2-enyl)-4-phenylpiperidin-4-ol;oxalate;propanoate |
| SMILES | CCC(=O)[O-].O=C([O-])C(=O)[O-].OC1(c2ccccc2)CCN(CC=C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H27NO.C3H6O2.C2H2O4/c28-26(24-14-8-3-9-15-24)17-20-27(21-18-26)19-16-25(22-10-4-1-5-11-22)23-12-6-2-7-13-23;1-2-3(4)5;3-1(4)2(5)6/h1-16,28H,17-21H2;2H2,1H3,(H,4,5);(H,3,4)(H,5,6)/p-3 |
| InChIKey | FAWWCOCKKLJKLW-UHFFFAOYSA-K |
| XLogP | 0.73 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|