C13H8I3NO2 — CID 21127304
[2,3-diiodo-6-(phenylcarbamoyl)phenyl] hypoiodite (PubChem CID 21127304) has the molecular formula C13H8I3NO2 and a molecular weight of 590.92 g/mol. Its IUPAC name is [2,3-diiodo-6-(phenylcarbamoyl)phenyl] hypoiodite.
| Compound Name | [2,3-diiodo-6-(phenylcarbamoyl)phenyl] hypoiodite |
|---|---|
| PubChem CID | 21127304 |
| Molecular Formula | C13H8I3NO2 |
| Molecular Weight | 590.92 g/mol |
| Exact Mass | 590.77 |
| IUPAC Name | [2,3-diiodo-6-(phenylcarbamoyl)phenyl] hypoiodite |
| SMILES | O=C(Nc1ccccc1)c1ccc(I)c(I)c1OI |
| InChI | InChI=1S/C13H8I3NO2/c14-10-7-6-9(12(19-16)11(10)15)13(18)17-8-4-2-1-3-5-8/h1-7H,(H,17,18) |
| InChIKey | DGVSRDBAJKZYJZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|