C22H36NO9-4 — CID 21127313
CID 21127313 (PubChem CID 21127313) has the molecular formula C22H36NO9-4 and a molecular weight of 458.53 g/mol.
| Compound Name | CID 21127313 |
|---|---|
| PubChem CID | 21127313 |
| Molecular Formula | C22H36NO9-4 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | — |
| SMILES | CCC(C(=O)[O-])C1CCCCC1.O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[CH2]CN(CC)CC |
| InChI | InChI=1S/C10H18O2.C6H14N.C6H8O7/c1-2-9(10(11)12)8-6-4-3-5-7-8;1-4-7(5-2)6-3;7-3(8)1-6(13,5(11)12)2-4(9)10/h8-9H,2-7H2,1H3,(H,11,12);1,4-6H2,2-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-4 |
| InChIKey | OHURLRXJAJJLQD-UHFFFAOYSA-J |
| XLogP | -2.75 |
| TPSA | 183.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |