C16H24Cl2N2O6S4-2 — CID 21127911
bis(5-(2-chloroethyl)-2,4-dimethyl-1,3-thiazole);ethane-1,2-disulfonate (PubChem CID 21127911) has the molecular formula C16H24Cl2N2O6S4-2 and a molecular weight of 539.55 g/mol. Its IUPAC name is bis(5-(2-chloroethyl)-2,4-dimethyl-1,3-thiazole);ethane-1,2-disulfonate.
| Compound Name | bis(5-(2-chloroethyl)-2,4-dimethyl-1,3-thiazole);ethane-1,2-disulfonate |
|---|---|
| PubChem CID | 21127911 |
| Molecular Formula | C16H24Cl2N2O6S4-2 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 537.99 |
| IUPAC Name | bis(5-(2-chloroethyl)-2,4-dimethyl-1,3-thiazole);ethane-1,2-disulfonate |
| SMILES | Cc1nc(C)c(CCCl)s1.Cc1nc(C)c(CCCl)s1.O=S(=O)([O-])CCS(=O)(=O)[O-] |
| InChI | InChI=1S/2C7H10ClNS.C2H6O6S2/c2*1-5-7(3-4-8)10-6(2)9-5;3-9(4,5)1-2-10(6,7)8/h2*3-4H2,1-2H3;1-2H2,(H,3,4,5)(H,6,7,8)/p-2 |
| InChIKey | SOLPJXUVTOFGIN-UHFFFAOYSA-L |
| XLogP | 3.16 |
| TPSA | 140.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|