C16H28N4O6S4-2 — CID 21127893
ethane-1,2-disulfonate;bis(4-methyl-5-propyl-1,3-thiazol-2-amine) (PubChem CID 21127893) has the molecular formula C16H28N4O6S4-2 and a molecular weight of 500.69 g/mol. Its IUPAC name is ethane-1,2-disulfonate;bis(4-methyl-5-propyl-1,3-thiazol-2-amine).
| Compound Name | ethane-1,2-disulfonate;bis(4-methyl-5-propyl-1,3-thiazol-2-amine) |
|---|---|
| PubChem CID | 21127893 |
| Molecular Formula | C16H28N4O6S4-2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | ethane-1,2-disulfonate;bis(4-methyl-5-propyl-1,3-thiazol-2-amine) |
| SMILES | CCCc1sc(N)nc1C.CCCc1sc(N)nc1C.O=S(=O)([O-])CCS(=O)(=O)[O-] |
| InChI | InChI=1S/2C7H12N2S.C2H6O6S2/c2*1-3-4-6-5(2)9-7(8)10-6;3-9(4,5)1-2-10(6,7)8/h2*3-4H2,1-2H3,(H2,8,9);1-2H2,(H,3,4,5)(H,6,7,8)/p-2 |
| InChIKey | FTRVRLHWLMGAFP-UHFFFAOYSA-L |
| XLogP | 2.05 |
| TPSA | 192.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|