C22H25NO5-2 — CID 21128015
2-benzhydrylpiperidin-3-ol;butanedioate (PubChem CID 21128015) has the molecular formula C22H25NO5-2 and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-benzhydrylpiperidin-3-ol;butanedioate.
| Compound Name | 2-benzhydrylpiperidin-3-ol;butanedioate |
|---|---|
| PubChem CID | 21128015 |
| Molecular Formula | C22H25NO5-2 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-benzhydrylpiperidin-3-ol;butanedioate |
| SMILES | O=C([O-])CCC(=O)[O-].OC1CCCNC1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO.C4H6O4/c20-16-12-7-13-19-18(16)17(14-8-3-1-4-9-14)15-10-5-2-6-11-15;5-3(6)1-2-4(7)8/h1-6,8-11,16-20H,7,12-13H2;1-2H2,(H,5,6)(H,7,8)/p-2 |
| InChIKey | SSABUJNOBXZRQM-UHFFFAOYSA-L |
| XLogP | 0.20 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |